2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid

C10H8N2O4 — CID 2755916

IUPAC2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid
SMILESO=C(O)Cn1c(=O)[nH]c2ccccc2c1=O
InChIInChI=1S/C10H8N2O4/c13-8(14)5-12-9(15)6-3-1-2-4-7(6)11-10(12)16/h1-4H,5H2,(H,11,16)(H,13,14)
InChIKeyRQQGYSJFFRKGNY-UHFFFAOYSA-N
MW220.18 g/mol
LogP-0.23
Rot. Bonds2

About 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid

2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid (PubChem CID 2755916) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid
PubChem CID2755916
Molecular FormulaC10H8N2O4
Molecular Weight220.18 g/mol
Exact Mass220.05
IUPAC Name2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid
SMILESO=C(O)Cn1c(=O)[nH]c2ccccc2c1=O
InChIInChI=1S/C10H8N2O4/c13-8(14)5-12-9(15)6-3-1-2-4-7(6)11-10(12)16/h1-4H,5H2,(H,11,16)(H,13,14)
InChIKeyRQQGYSJFFRKGNY-UHFFFAOYSA-N
XLogP-0.23
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.18
LogP ≤ 5-0.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid?
The IUPAC name of 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid (CID 2755916) is 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid.
What is the SMILES notation for 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid?
The canonical SMILES for 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid is O=C(O)Cn1c(=O)[nH]c2ccccc2c1=O.
What is the InChIKey of 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid?
The InChIKey is RQQGYSJFFRKGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4/c13-8(14)5-12-9(15)6-3-1-2-4-7(6)11-10(12)16/h1-4H,5H2,(H,11,16)(H,13,14).
What are the key properties of 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid?
2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid has a molecular weight of 220.18 g/mol, XLogP of -0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid is sourced from PubChem (CID 2755916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).