C10H8N2O4 — CID 2755916
2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid (PubChem CID 2755916) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid.
| Compound Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid |
|---|---|
| PubChem CID | 2755916 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid |
| SMILES | O=C(O)Cn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C10H8N2O4/c13-8(14)5-12-9(15)6-3-1-2-4-7(6)11-10(12)16/h1-4H,5H2,(H,11,16)(H,13,14) |
| InChIKey | RQQGYSJFFRKGNY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |