C22H17NO4 — CID 2756082
4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (PubChem CID 2756082) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid.
| Compound Name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 2756082 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H17NO4/c24-21(25)14-9-11-15(12-10-14)23-22(26)27-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20H,13H2,(H,23,26)(H,24,25) |
| InChIKey | VGSYYBSAOANSLR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |