C23H21N5O3S — CID 27566548
2-(4-methylphenyl)-N'-(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 27566548) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N'-(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(4-methylphenyl)-N'-(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 27566548 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-(4-methylphenyl)-N'-(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(-c2nc(C(=O)NNC(=O)c3nn(C(C)C)c(=O)c4ccccc34)cs2)cc1 |
| InChI | InChI=1S/C23H21N5O3S/c1-13(2)28-23(31)17-7-5-4-6-16(17)19(27-28)21(30)26-25-20(29)18-12-32-22(24-18)15-10-8-14(3)9-11-15/h4-13H,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | XLANLJFPCIORSI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|