C23H23N5O2S — CID 24672388
N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-(4-propan-2-ylphenyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 24672388) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-(4-propan-2-ylphenyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-(4-propan-2-ylphenyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24672388 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-2-(4-propan-2-ylphenyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | CCn1c(NNC(=O)c2csc(-c3ccc(C(C)C)cc3)n2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H23N5O2S/c1-4-28-22(30)17-7-5-6-8-18(17)25-23(28)27-26-20(29)19-13-31-21(24-19)16-11-9-15(10-12-16)14(2)3/h5-14H,4H2,1-3H3,(H,25,27)(H,26,29) |
| InChIKey | NZZOPYYHYMHKQC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|