C8H4Cl2F4 — CID 2756724
1,4-bis(chloromethyl)-2,3,5,6-tetrafluorobenzene (PubChem CID 2756724) has the molecular formula C8H4Cl2F4 and a molecular weight of 247.02 g/mol. Its IUPAC name is 1,4-bis(chloromethyl)-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1,4-bis(chloromethyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 2756724 |
| Molecular Formula | C8H4Cl2F4 |
| Molecular Weight | 247.02 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 1,4-bis(chloromethyl)-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(CCl)c(F)c(F)c1CCl |
| InChI | InChI=1S/C8H4Cl2F4/c9-1-3-5(11)7(13)4(2-10)8(14)6(3)12/h1-2H2 |
| InChIKey | WEUAASLFNKTIIM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.02 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|