C7Cl3F5 — CID 2782621
1,2,3,4,5-pentafluoro-6-(trichloromethyl)benzene (PubChem CID 2782621) has the molecular formula C7Cl3F5 and a molecular weight of 285.43 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(trichloromethyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(trichloromethyl)benzene |
|---|---|
| PubChem CID | 2782621 |
| Molecular Formula | C7Cl3F5 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 283.90 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(trichloromethyl)benzene |
| SMILES | Fc1c(F)c(F)c(C(Cl)(Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C7Cl3F5/c8-7(9,10)1-2(11)4(13)6(15)5(14)3(1)12 |
| InChIKey | VYXYRHITHKKNMG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|