C7Cl2F6 — CID 2782510
1,3-dichloro-2,4,6-trifluoro-5-(trifluoromethyl)benzene (PubChem CID 2782510) has the molecular formula C7Cl2F6 and a molecular weight of 268.97 g/mol. Its IUPAC name is 1,3-dichloro-2,4,6-trifluoro-5-(trifluoromethyl)benzene.
| Compound Name | 1,3-dichloro-2,4,6-trifluoro-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 2782510 |
| Molecular Formula | C7Cl2F6 |
| Molecular Weight | 268.97 g/mol |
| Exact Mass | 267.93 |
| IUPAC Name | 1,3-dichloro-2,4,6-trifluoro-5-(trifluoromethyl)benzene |
| SMILES | Fc1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl |
| InChI | InChI=1S/C7Cl2F6/c8-2-4(10)1(7(13,14)15)5(11)3(9)6(2)12 |
| InChIKey | GMAAQKFDAJMAFP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.97 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|