C8Cl6F4 — CID 631628
1,2,4,5-tetrafluoro-3,6-bis(trichloromethyl)benzene (PubChem CID 631628) has the molecular formula C8Cl6F4 and a molecular weight of 384.80 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-bis(trichloromethyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-bis(trichloromethyl)benzene |
|---|---|
| PubChem CID | 631628 |
| Molecular Formula | C8Cl6F4 |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 381.81 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-bis(trichloromethyl)benzene |
| SMILES | Fc1c(F)c(C(Cl)(Cl)Cl)c(F)c(F)c1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8Cl6F4/c9-7(10,11)1-3(15)5(17)2(8(12,13)14)6(18)4(1)16 |
| InChIKey | OUCGHEXZLLSGFY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|