C12H17ClN2O3S — CID 2757353
4-(butylcarbamoylamino)-2-methylbenzenesulfonyl chloride (PubChem CID 2757353) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 4-(butylcarbamoylamino)-2-methylbenzenesulfonyl chloride.
| Compound Name | 4-(butylcarbamoylamino)-2-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 2757353 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-(butylcarbamoylamino)-2-methylbenzenesulfonyl chloride |
| SMILES | CCCCNC(=O)Nc1ccc(S(=O)(=O)Cl)c(C)c1 |
| InChI | InChI=1S/C12H17ClN2O3S/c1-3-4-7-14-12(16)15-10-5-6-11(9(2)8-10)19(13,17)18/h5-6,8H,3-4,7H2,1-2H3,(H2,14,15,16) |
| InChIKey | SQAXKSRGKWAYEX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|