C14H22N2 — CID 2758613
1-[1-(3,4-dimethylphenyl)ethyl]piperazine (PubChem CID 2758613) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylphenyl)ethyl]piperazine.
| Compound Name | 1-[1-(3,4-dimethylphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 2758613 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-[1-(3,4-dimethylphenyl)ethyl]piperazine |
| SMILES | Cc1ccc(C(C)N2CCNCC2)cc1C |
| InChI | InChI=1S/C14H22N2/c1-11-4-5-14(10-12(11)2)13(3)16-8-6-15-7-9-16/h4-5,10,13,15H,6-9H2,1-3H3 |
| InChIKey | KIZHKDIPORTYKA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |