About furan-2-carbonyl isothiocyanate
furan-2-carbonyl isothiocyanate (PubChem CID 2759243) has the molecular formula C6H3NO2S
and a molecular weight of 153.16 g/mol. Its IUPAC name is furan-2-carbonyl isothiocyanate.
Molecular Properties
| Compound Name | furan-2-carbonyl isothiocyanate |
| PubChem CID | 2759243 |
| Molecular Formula | C6H3NO2S |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 152.99 |
| IUPAC Name | furan-2-carbonyl isothiocyanate |
| SMILES | O=C(N=C=S)c1ccco1 |
| InChI | InChI=1S/C6H3NO2S/c8-6(7-4-10)5-2-1-3-9-5/h1-3H |
| InChIKey | ILQPDHJLKUOZTC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze furan-2-carbonyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-carbonyl isothiocyanate?
The IUPAC name of furan-2-carbonyl isothiocyanate (CID 2759243) is furan-2-carbonyl isothiocyanate.
What is the SMILES notation for furan-2-carbonyl isothiocyanate?
The canonical SMILES for furan-2-carbonyl isothiocyanate is O=C(N=C=S)c1ccco1.
What is the InChIKey of furan-2-carbonyl isothiocyanate?
The InChIKey is ILQPDHJLKUOZTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3NO2S/c8-6(7-4-10)5-2-1-3-9-5/h1-3H.
What are the key properties of furan-2-carbonyl isothiocyanate?
furan-2-carbonyl isothiocyanate has a molecular weight of 153.16 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-carbonyl isothiocyanate is sourced from PubChem (CID 2759243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).