About 1-amino-3-hexylthiourea
1-amino-3-hexylthiourea (PubChem CID 2759283) has the molecular formula C7H17N3S
and a molecular weight of 175.30 g/mol. Its IUPAC name is 1-amino-3-hexylthiourea.
Molecular Properties
| Compound Name | 1-amino-3-hexylthiourea |
| PubChem CID | 2759283 |
| Molecular Formula | C7H17N3S |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-amino-3-hexylthiourea |
| SMILES | CCCCCCNC(=S)NN |
| InChI | InChI=1S/C7H17N3S/c1-2-3-4-5-6-9-7(11)10-8/h2-6,8H2,1H3,(H2,9,10,11) |
| InChIKey | JYGCXTZCHMEVCG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-hexylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-hexylthiourea?
The IUPAC name of 1-amino-3-hexylthiourea (CID 2759283) is 1-amino-3-hexylthiourea.
What is the SMILES notation for 1-amino-3-hexylthiourea?
The canonical SMILES for 1-amino-3-hexylthiourea is CCCCCCNC(=S)NN.
What is the InChIKey of 1-amino-3-hexylthiourea?
The InChIKey is JYGCXTZCHMEVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3S/c1-2-3-4-5-6-9-7(11)10-8/h2-6,8H2,1H3,(H2,9,10,11).
What are the key properties of 1-amino-3-hexylthiourea?
1-amino-3-hexylthiourea has a molecular weight of 175.30 g/mol, XLogP of 0.90, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-hexylthiourea is sourced from PubChem (CID 2759283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).