C22H23ClN4O5 — CID 27600419
N'-[2-(4-chloro-2-methylphenoxy)acetyl]-2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetohydrazide (PubChem CID 27600419) has the molecular formula C22H23ClN4O5 and a molecular weight of 458.90 g/mol. Its IUPAC name is N'-[2-(4-chloro-2-methylphenoxy)acetyl]-2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetohydrazide.
| Compound Name | N'-[2-(4-chloro-2-methylphenoxy)acetyl]-2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 27600419 |
| Molecular Formula | C22H23ClN4O5 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N'-[2-(4-chloro-2-methylphenoxy)acetyl]-2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetohydrazide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(CC(=O)NNC(=O)COc2ccc(Cl)cc2C)C1=O |
| InChI | InChI=1S/C22H23ClN4O5/c1-3-22(15-7-5-4-6-8-15)20(30)27(21(31)24-22)12-18(28)25-26-19(29)13-32-17-10-9-16(23)11-14(17)2/h4-11H,3,12-13H2,1-2H3,(H,24,31)(H,25,28)(H,26,29)/t22-/m0/s1 |
| InChIKey | RQCUTPVXOHDPGG-QFIPXVFZSA-N |
| XLogP | 2.03 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|