About (4-nitrophenyl)thiourea
(4-nitrophenyl)thiourea (PubChem CID 2760234) has the molecular formula C7H7N3O2S
and a molecular weight of 197.22 g/mol. Its IUPAC name is (4-nitrophenyl)thiourea.
Molecular Properties
| Compound Name | (4-nitrophenyl)thiourea |
| PubChem CID | 2760234 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | (4-nitrophenyl)thiourea |
| SMILES | NC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H7N3O2S/c8-7(13)9-5-1-3-6(4-2-5)10(11)12/h1-4H,(H3,8,9,13) |
| InChIKey | BLYAANPIHFKKMQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)thiourea?
The IUPAC name of (4-nitrophenyl)thiourea (CID 2760234) is (4-nitrophenyl)thiourea.
What is the SMILES notation for (4-nitrophenyl)thiourea?
The canonical SMILES for (4-nitrophenyl)thiourea is NC(=S)Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)thiourea?
The InChIKey is BLYAANPIHFKKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S/c8-7(13)9-5-1-3-6(4-2-5)10(11)12/h1-4H,(H3,8,9,13).
What are the key properties of (4-nitrophenyl)thiourea?
(4-nitrophenyl)thiourea has a molecular weight of 197.22 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)thiourea is sourced from PubChem (CID 2760234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).