About methyl piperazine-2-carboxylate
methyl piperazine-2-carboxylate (PubChem CID 2760426) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is methyl piperazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl piperazine-2-carboxylate |
| PubChem CID | 2760426 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | methyl piperazine-2-carboxylate |
| SMILES | COC(=O)C1CNCCN1 |
| InChI | InChI=1S/C6H12N2O2/c1-10-6(9)5-4-7-2-3-8-5/h5,7-8H,2-4H2,1H3 |
| InChIKey | ODQZNBWVRPKMKN-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl piperazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl piperazine-2-carboxylate?
The IUPAC name of methyl piperazine-2-carboxylate (CID 2760426) is methyl piperazine-2-carboxylate.
What is the SMILES notation for methyl piperazine-2-carboxylate?
The canonical SMILES for methyl piperazine-2-carboxylate is COC(=O)C1CNCCN1.
What is the InChIKey of methyl piperazine-2-carboxylate?
The InChIKey is ODQZNBWVRPKMKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-10-6(9)5-4-7-2-3-8-5/h5,7-8H,2-4H2,1H3.
What are the key properties of methyl piperazine-2-carboxylate?
methyl piperazine-2-carboxylate has a molecular weight of 144.17 g/mol, XLogP of -1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl piperazine-2-carboxylate is sourced from PubChem (CID 2760426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).