C23H26N4O5S — CID 27615256
N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide (PubChem CID 27615256) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide.
| Compound Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
|---|---|
| PubChem CID | 27615256 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)NCCN1C(=O)S/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C23H26N4O5S/c28-18(9-13-27-20(30)23(25-21(27)31)10-5-2-6-11-23)24-12-14-26-19(29)17(33-22(26)32)15-16-7-3-1-4-8-16/h1,3-4,7-8,15H,2,5-6,9-14H2,(H,24,28)(H,25,31)/b17-15- |
| InChIKey | JHYRZXCNKIHHSN-ICFOKQHNSA-N |
| XLogP | 2.48 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|