About 2H-1,3-benzoxazine
2H-1,3-benzoxazine (PubChem CID 2762566) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2H-1,3-benzoxazine.
Molecular Properties
| Compound Name | 2H-1,3-benzoxazine |
| PubChem CID | 2762566 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 2H-1,3-benzoxazine |
| SMILES | C1=NCOc2ccccc21 |
| InChI | InChI=1S/C8H7NO/c1-2-4-8-7(3-1)5-9-6-10-8/h1-5H,6H2 |
| InChIKey | CGACGSHTSCXSSO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,3-benzoxazine?
The IUPAC name of 2H-1,3-benzoxazine (CID 2762566) is 2H-1,3-benzoxazine.
What is the SMILES notation for 2H-1,3-benzoxazine?
The canonical SMILES for 2H-1,3-benzoxazine is C1=NCOc2ccccc21.
What is the InChIKey of 2H-1,3-benzoxazine?
The InChIKey is CGACGSHTSCXSSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c1-2-4-8-7(3-1)5-9-6-10-8/h1-5H,6H2.
What are the key properties of 2H-1,3-benzoxazine?
2H-1,3-benzoxazine has a molecular weight of 133.15 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,3-benzoxazine is sourced from PubChem (CID 2762566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).