C10H10ClNO — CID 602084
4-chloro-2,2-dimethyl-1,3-benzoxazine (PubChem CID 602084) has the molecular formula C10H10ClNO and a molecular weight of 195.65 g/mol. Its IUPAC name is 4-chloro-2,2-dimethyl-1,3-benzoxazine.
| Compound Name | 4-chloro-2,2-dimethyl-1,3-benzoxazine |
|---|---|
| PubChem CID | 602084 |
| Molecular Formula | C10H10ClNO |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 4-chloro-2,2-dimethyl-1,3-benzoxazine |
| SMILES | CC1(C)N=C(Cl)c2ccccc2O1 |
| InChI | InChI=1S/C10H10ClNO/c1-10(2)12-9(11)7-5-3-4-6-8(7)13-10/h3-6H,1-2H3 |
| InChIKey | FKSOZOHKBSIGTI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |