N-hydroxy-2-methoxybenzenecarboximidoyl chloride

C8H8ClNO2 — CID 57353351

IUPACN-hydroxy-2-methoxybenzenecarboximidoyl chloride
SMILESCOc1ccccc1C(Cl)=NO
InChIInChI=1S/C8H8ClNO2/c1-12-7-5-3-2-4-6(7)8(9)10-11/h2-5,11H,1H3
InChIKeyKVDMQNUSKPRBGU-UHFFFAOYSA-N
MW185.61 g/mol
LogP2.07
Rot. Bonds2

About N-hydroxy-2-methoxybenzenecarboximidoyl chloride

N-hydroxy-2-methoxybenzenecarboximidoyl chloride (PubChem CID 57353351) has the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. Its IUPAC name is N-hydroxy-2-methoxybenzenecarboximidoyl chloride.

Molecular Properties

Compound NameN-hydroxy-2-methoxybenzenecarboximidoyl chloride
PubChem CID57353351
Molecular FormulaC8H8ClNO2
Molecular Weight185.61 g/mol
Exact Mass185.02
IUPAC NameN-hydroxy-2-methoxybenzenecarboximidoyl chloride
SMILESCOc1ccccc1C(Cl)=NO
InChIInChI=1S/C8H8ClNO2/c1-12-7-5-3-2-4-6(7)8(9)10-11/h2-5,11H,1H3
InChIKeyKVDMQNUSKPRBGU-UHFFFAOYSA-N
XLogP2.07
TPSA41.82 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.61
LogP ≤ 52.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze N-hydroxy-2-methoxybenzenecarboximidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-hydroxy-2-methoxybenzenecarboximidoyl chloride?
The IUPAC name of N-hydroxy-2-methoxybenzenecarboximidoyl chloride (CID 57353351) is N-hydroxy-2-methoxybenzenecarboximidoyl chloride.
What is the SMILES notation for N-hydroxy-2-methoxybenzenecarboximidoyl chloride?
The canonical SMILES for N-hydroxy-2-methoxybenzenecarboximidoyl chloride is COc1ccccc1C(Cl)=NO.
What is the InChIKey of N-hydroxy-2-methoxybenzenecarboximidoyl chloride?
The InChIKey is KVDMQNUSKPRBGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2/c1-12-7-5-3-2-4-6(7)8(9)10-11/h2-5,11H,1H3.
What are the key properties of N-hydroxy-2-methoxybenzenecarboximidoyl chloride?
N-hydroxy-2-methoxybenzenecarboximidoyl chloride has a molecular weight of 185.61 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2-methoxybenzenecarboximidoyl chloride is sourced from PubChem (CID 57353351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).