About N-methylxanthen-9-imine
N-methylxanthen-9-imine (PubChem CID 14265482) has the molecular formula C14H11NO
and a molecular weight of 209.25 g/mol. Its IUPAC name is N-methylxanthen-9-imine.
Molecular Properties
| Compound Name | N-methylxanthen-9-imine |
| PubChem CID | 14265482 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | N-methylxanthen-9-imine |
| SMILES | CN=c1c2ccccc2oc2ccccc12 |
| InChI | InChI=1S/C14H11NO/c1-15-14-10-6-2-4-8-12(10)16-13-9-5-3-7-11(13)14/h2-9H,1H3 |
| InChIKey | NGSNLKUIJMXGBH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylxanthen-9-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylxanthen-9-imine?
The IUPAC name of N-methylxanthen-9-imine (CID 14265482) is N-methylxanthen-9-imine.
What is the SMILES notation for N-methylxanthen-9-imine?
The canonical SMILES for N-methylxanthen-9-imine is CN=c1c2ccccc2oc2ccccc12.
What is the InChIKey of N-methylxanthen-9-imine?
The InChIKey is NGSNLKUIJMXGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO/c1-15-14-10-6-2-4-8-12(10)16-13-9-5-3-7-11(13)14/h2-9H,1H3.
What are the key properties of N-methylxanthen-9-imine?
N-methylxanthen-9-imine has a molecular weight of 209.25 g/mol, XLogP of 3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylxanthen-9-imine is sourced from PubChem (CID 14265482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).