About 4-bromo-2-fluoropyridine
4-bromo-2-fluoropyridine (PubChem CID 2762851) has the molecular formula C5H3BrFN
and a molecular weight of 175.99 g/mol. Its IUPAC name is 4-bromo-2-fluoropyridine.
Molecular Properties
| Compound Name | 4-bromo-2-fluoropyridine |
| PubChem CID | 2762851 |
| Molecular Formula | C5H3BrFN |
| Molecular Weight | 175.99 g/mol |
| Exact Mass | 174.94 |
| IUPAC Name | 4-bromo-2-fluoropyridine |
| SMILES | Fc1cc(Br)ccn1 |
| InChI | InChI=1S/C5H3BrFN/c6-4-1-2-8-5(7)3-4/h1-3H |
| InChIKey | PTPTZLXZHPPVKG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.99 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-fluoropyridine?
The IUPAC name of 4-bromo-2-fluoropyridine (CID 2762851) is 4-bromo-2-fluoropyridine.
What is the SMILES notation for 4-bromo-2-fluoropyridine?
The canonical SMILES for 4-bromo-2-fluoropyridine is Fc1cc(Br)ccn1.
What is the InChIKey of 4-bromo-2-fluoropyridine?
The InChIKey is PTPTZLXZHPPVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrFN/c6-4-1-2-8-5(7)3-4/h1-3H.
What are the key properties of 4-bromo-2-fluoropyridine?
4-bromo-2-fluoropyridine has a molecular weight of 175.99 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-fluoropyridine is sourced from PubChem (CID 2762851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).