C5H5N — CID 558519
2,3,4,5,6-pentadeuteriopyridine (PubChem CID 558519) has the molecular formula C5H5N and a molecular weight of 84.13 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuteriopyridine.
| Compound Name | 2,3,4,5,6-pentadeuteriopyridine |
|---|---|
| PubChem CID | 558519 |
| Molecular Formula | C5H5N |
| Molecular Weight | 84.13 g/mol |
| Exact Mass | 84.07 |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| SMILES | [2H]c1nc([2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C5H5N/c1-2-4-6-5-3-1/h1-5H/i1D,2D,3D,4D,5D |
| InChIKey | JUJWROOIHBZHMG-RALIUCGRSA-N |
| XLogP | 1.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 84.13 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |