About 5-bromo-2-phenylpyridine
5-bromo-2-phenylpyridine (PubChem CID 2762862) has the molecular formula C11H8BrN
and a molecular weight of 234.10 g/mol. Its IUPAC name is 5-bromo-2-phenylpyridine.
Molecular Properties
| Compound Name | 5-bromo-2-phenylpyridine |
| PubChem CID | 2762862 |
| Molecular Formula | C11H8BrN |
| Molecular Weight | 234.10 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | 5-bromo-2-phenylpyridine |
| SMILES | Brc1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C11H8BrN/c12-10-6-7-11(13-8-10)9-4-2-1-3-5-9/h1-8H |
| InChIKey | PRNGIODVYLTUKH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.10 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-phenylpyridine?
The IUPAC name of 5-bromo-2-phenylpyridine (CID 2762862) is 5-bromo-2-phenylpyridine.
What is the SMILES notation for 5-bromo-2-phenylpyridine?
The canonical SMILES for 5-bromo-2-phenylpyridine is Brc1ccc(-c2ccccc2)nc1.
What is the InChIKey of 5-bromo-2-phenylpyridine?
The InChIKey is PRNGIODVYLTUKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrN/c12-10-6-7-11(13-8-10)9-4-2-1-3-5-9/h1-8H.
What are the key properties of 5-bromo-2-phenylpyridine?
5-bromo-2-phenylpyridine has a molecular weight of 234.10 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-phenylpyridine is sourced from PubChem (CID 2762862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).