C22H26N4OS — CID 27629051
(3Z)-1-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one (PubChem CID 27629051) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is (3Z)-1-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one.
| Compound Name | (3Z)-1-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 27629051 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (3Z)-1-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
| SMILES | CN1/C(=C\C(=O)CSc2nnc(C3CC3)n2C2CC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H26N4OS/c1-22(2)17-6-4-5-7-18(17)25(3)19(22)12-16(27)13-28-21-24-23-20(14-8-9-14)26(21)15-10-11-15/h4-7,12,14-15H,8-11,13H2,1-3H3/b19-12- |
| InChIKey | OEINULDXWTYQKW-UNOMPAQXSA-N |
| XLogP | 4.46 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|