C14H12O2S — CID 2763430
methyl 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate (PubChem CID 2763430) has the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. Its IUPAC name is methyl 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate.
| Compound Name | methyl 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate |
|---|---|
| PubChem CID | 2763430 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | methyl 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)-c1ccccc1CC2 |
| InChI | InChI=1S/C14H12O2S/c1-16-14(15)12-8-10-7-6-9-4-2-3-5-11(9)13(10)17-12/h2-5,8H,6-7H2,1H3 |
| InChIKey | UYQCQEAAPIETRL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |