C14H17N5O2 — CID 2763542
ethyl N-(5-amino-1-phenylpyrazole-4-carbonyl)ethanehydrazonate (PubChem CID 2763542) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl N-(5-amino-1-phenylpyrazole-4-carbonyl)ethanehydrazonate.
| Compound Name | ethyl N-(5-amino-1-phenylpyrazole-4-carbonyl)ethanehydrazonate |
|---|---|
| PubChem CID | 2763542 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | ethyl N-(5-amino-1-phenylpyrazole-4-carbonyl)ethanehydrazonate |
| SMILES | CCOC(C)=NNC(=O)c1cnn(-c2ccccc2)c1N |
| InChI | InChI=1S/C14H17N5O2/c1-3-21-10(2)17-18-14(20)12-9-16-19(13(12)15)11-7-5-4-6-8-11/h4-9H,3,15H2,1-2H3,(H,18,20) |
| InChIKey | LCGQSAQHSIXDBZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|