C11H8ClN3O3 — CID 2763787
5-acetyl-1-(2-chloro-3-pyridinyl)pyrimidine-2,4-dione (PubChem CID 2763787) has the molecular formula C11H8ClN3O3 and a molecular weight of 265.66 g/mol. Its IUPAC name is 5-acetyl-1-(2-chloro-3-pyridinyl)pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-1-(2-chloro-3-pyridinyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2763787 |
| Molecular Formula | C11H8ClN3O3 |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 5-acetyl-1-(2-chloro-3-pyridinyl)pyrimidine-2,4-dione |
| SMILES | CC(=O)c1cn(-c2cccnc2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H8ClN3O3/c1-6(16)7-5-15(11(18)14-10(7)17)8-3-2-4-13-9(8)12/h2-5H,1H3,(H,14,17,18) |
| InChIKey | MIISKJZDVVSZQX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|