C10H8ClNO3 — CID 2764458
6-(2-chloroacetyl)-4H-1,4-benzoxazin-3-one (PubChem CID 2764458) has the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. Its IUPAC name is 6-(2-chloroacetyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-chloroacetyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2764458 |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 6-(2-chloroacetyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(=O)CCl)cc2N1 |
| InChI | InChI=1S/C10H8ClNO3/c11-4-8(13)6-1-2-9-7(3-6)12-10(14)5-15-9/h1-3H,4-5H2,(H,12,14) |
| InChIKey | MIAHXWVABDHISZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|