C14H17ClF3N3O — CID 2765109
N-(3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-ylmethyl)-3-chloro-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 2765109) has the molecular formula C14H17ClF3N3O and a molecular weight of 335.76 g/mol. Its IUPAC name is N-(3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-ylmethyl)-3-chloro-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-ylmethyl)-3-chloro-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 2765109 |
| Molecular Formula | C14H17ClF3N3O |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-(3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-ylmethyl)-3-chloro-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cnc(NCC2CC3CCCCN3O2)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClF3N3O/c15-12-5-9(14(16,17)18)7-19-13(12)20-8-11-6-10-3-1-2-4-21(10)22-11/h5,7,10-11H,1-4,6,8H2,(H,19,20) |
| InChIKey | VSZHYSAMQGJTER-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |