C16H13F2NO3S — CID 27653287
N-[2-(3,4-difluorophenyl)sulfanylacetyl]-4-methoxybenzamide (PubChem CID 27653287) has the molecular formula C16H13F2NO3S and a molecular weight of 337.35 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)sulfanylacetyl]-4-methoxybenzamide.
| Compound Name | N-[2-(3,4-difluorophenyl)sulfanylacetyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 27653287 |
| Molecular Formula | C16H13F2NO3S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)sulfanylacetyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=O)CSc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H13F2NO3S/c1-22-11-4-2-10(3-5-11)16(21)19-15(20)9-23-12-6-7-13(17)14(18)8-12/h2-8H,9H2,1H3,(H,19,20,21) |
| InChIKey | GLYBJPBOGFDBIF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |