C14H11Cl2F3N4O2 — CID 2765666
N-(2-chloro-6-nitrophenyl)-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine (PubChem CID 2765666) has the molecular formula C14H11Cl2F3N4O2 and a molecular weight of 395.17 g/mol. Its IUPAC name is N-(2-chloro-6-nitrophenyl)-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine.
| Compound Name | N-(2-chloro-6-nitrophenyl)-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 2765666 |
| Molecular Formula | C14H11Cl2F3N4O2 |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | N-(2-chloro-6-nitrophenyl)-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H11Cl2F3N4O2/c15-9-2-1-3-11(23(24)25)12(9)20-4-5-21-13-10(16)6-8(7-22-13)14(17,18)19/h1-3,6-7,20H,4-5H2,(H,21,22) |
| InChIKey | YVPUHCJLDDRJSF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|