C10H10N2O2S — CID 2768377
5-[(4-aminophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2768377) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 5-[(4-aminophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-aminophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2768377 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 5-[(4-aminophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Nc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C10H10N2O2S/c11-7-3-1-6(2-4-7)5-8-9(13)12-10(14)15-8/h1-4,8H,5,11H2,(H,12,13,14) |
| InChIKey | QEVZXOBJHGOAML-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|