C17H19NOS2 — CID 27708228
(E)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 27708228) has the molecular formula C17H19NOS2 and a molecular weight of 317.48 g/mol. Its IUPAC name is (E)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 27708228 |
| Molecular Formula | C17H19NOS2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (E)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1ccc(CSCCNC(=O)/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C17H19NOS2/c1-14-4-6-15(7-5-14)13-20-12-10-18-17(19)9-8-16-3-2-11-21-16/h2-9,11H,10,12-13H2,1H3,(H,18,19)/b9-8+ |
| InChIKey | RBXDMMPAOGGVJW-CMDGGOBGSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|