C27H24N2O7 — CID 27723947
methyl 2-[[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carbonyl]oxymethyl]-4-methylquinoline-3-carboxylate (PubChem CID 27723947) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is methyl 2-[[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carbonyl]oxymethyl]-4-methylquinoline-3-carboxylate.
| Compound Name | methyl 2-[[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carbonyl]oxymethyl]-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 27723947 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | methyl 2-[[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carbonyl]oxymethyl]-4-methylquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(COC(=O)c2ccc3c(c2)C(=O)N(C[C@@H]2CCCO2)C3=O)nc2ccccc2c1C |
| InChI | InChI=1S/C27H24N2O7/c1-15-18-7-3-4-8-21(18)28-22(23(15)27(33)34-2)14-36-26(32)16-9-10-19-20(12-16)25(31)29(24(19)30)13-17-6-5-11-35-17/h3-4,7-10,12,17H,5-6,11,13-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | ZKIKEYXHPATMMK-KRWDZBQOSA-N |
| XLogP | 3.46 |
| TPSA | 112.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|