About 1H-benzimidazole-5,6-diamine
1H-benzimidazole-5,6-diamine (PubChem CID 2773193) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 1H-benzimidazole-5,6-diamine.
Molecular Properties
| Compound Name | 1H-benzimidazole-5,6-diamine |
| PubChem CID | 2773193 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1H-benzimidazole-5,6-diamine |
| SMILES | Nc1cc2nc[nH]c2cc1N |
| InChI | InChI=1S/C7H8N4/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-3H,8-9H2,(H,10,11) |
| InChIKey | SJVPHAOWYMKBPE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole-5,6-diamine?
The IUPAC name of 1H-benzimidazole-5,6-diamine (CID 2773193) is 1H-benzimidazole-5,6-diamine.
What is the SMILES notation for 1H-benzimidazole-5,6-diamine?
The canonical SMILES for 1H-benzimidazole-5,6-diamine is Nc1cc2nc[nH]c2cc1N.
What is the InChIKey of 1H-benzimidazole-5,6-diamine?
The InChIKey is SJVPHAOWYMKBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-3H,8-9H2,(H,10,11).
What are the key properties of 1H-benzimidazole-5,6-diamine?
1H-benzimidazole-5,6-diamine has a molecular weight of 148.17 g/mol, XLogP of 0.73, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole-5,6-diamine is sourced from PubChem (CID 2773193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).