C23H24FN3O4S — CID 27739609
3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-N-(furan-2-ylmethyl)-N-methylbenzamide (PubChem CID 27739609) has the molecular formula C23H24FN3O4S and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-N-(furan-2-ylmethyl)-N-methylbenzamide.
| Compound Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-N-(furan-2-ylmethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 27739609 |
| Molecular Formula | C23H24FN3O4S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-N-(furan-2-ylmethyl)-N-methylbenzamide |
| SMILES | CN(Cc1ccco1)C(=O)c1cccc(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C23H24FN3O4S/c1-25(17-21-5-3-15-31-21)23(28)18-4-2-6-22(16-18)32(29,30)27-13-11-26(12-14-27)20-9-7-19(24)8-10-20/h2-10,15-16H,11-14,17H2,1H3 |
| InChIKey | AYZLZNXEQDASLQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |