C18H13Cl3N4O — CID 2774836
4-methyl-N-[3-[(2,5,6-trichloropyrimidin-4-yl)amino]phenyl]benzamide (PubChem CID 2774836) has the molecular formula C18H13Cl3N4O and a molecular weight of 407.69 g/mol. Its IUPAC name is 4-methyl-N-[3-[(2,5,6-trichloropyrimidin-4-yl)amino]phenyl]benzamide.
| Compound Name | 4-methyl-N-[3-[(2,5,6-trichloropyrimidin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 2774836 |
| Molecular Formula | C18H13Cl3N4O |
| Molecular Weight | 407.69 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 4-methyl-N-[3-[(2,5,6-trichloropyrimidin-4-yl)amino]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(Nc3nc(Cl)nc(Cl)c3Cl)c2)cc1 |
| InChI | InChI=1S/C18H13Cl3N4O/c1-10-5-7-11(8-6-10)17(26)23-13-4-2-3-12(9-13)22-16-14(19)15(20)24-18(21)25-16/h2-9H,1H3,(H,23,26)(H,22,24,25) |
| InChIKey | WFGBWWAKUBOYDE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |