C9H6ClF3N2O2S2 — CID 2775671
5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene-2-sulfonyl chloride (PubChem CID 2775671) has the molecular formula C9H6ClF3N2O2S2 and a molecular weight of 330.74 g/mol. Its IUPAC name is 5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 2775671 |
| Molecular Formula | C9H6ClF3N2O2S2 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | 5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophene-2-sulfonyl chloride |
| SMILES | Cn1nc(-c2ccc(S(=O)(=O)Cl)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C9H6ClF3N2O2S2/c1-15-7(9(11,12)13)4-5(14-15)6-2-3-8(18-6)19(10,16)17/h2-4H,1H3 |
| InChIKey | BWVNHXIGDZASCP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |