C9H8F3N3O2S2 — CID 2820380
5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-sulfonamide (PubChem CID 2820380) has the molecular formula C9H8F3N3O2S2 and a molecular weight of 311.31 g/mol. Its IUPAC name is 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-sulfonamide.
| Compound Name | 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2820380 |
| Molecular Formula | C9H8F3N3O2S2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]thiophene-2-sulfonamide |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C9H8F3N3O2S2/c1-15-5(4-7(14-15)9(10,11)12)6-2-3-8(18-6)19(13,16)17/h2-4H,1H3,(H2,13,16,17) |
| InChIKey | YUINHXMHMCDGHD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |