C6Br5Cl — CID 2776021
1,2,3,4,5-pentabromo-6-chlorobenzene (PubChem CID 2776021) has the molecular formula C6Br5Cl and a molecular weight of 507.04 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-chlorobenzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-chlorobenzene |
|---|---|
| PubChem CID | 2776021 |
| Molecular Formula | C6Br5Cl |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 501.56 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-chlorobenzene |
| SMILES | Clc1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C6Br5Cl/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | ANUGBMGHBVDRKV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|