C6Br3Cl3 — CID 22311457
1,3,5-tribromo-2,4,6-trichlorobenzene (PubChem CID 22311457) has the molecular formula C6Br3Cl3 and a molecular weight of 418.14 g/mol. Its IUPAC name is 1,3,5-tribromo-2,4,6-trichlorobenzene.
| Compound Name | 1,3,5-tribromo-2,4,6-trichlorobenzene |
|---|---|
| PubChem CID | 22311457 |
| Molecular Formula | C6Br3Cl3 |
| Molecular Weight | 418.14 g/mol |
| Exact Mass | 413.66 |
| IUPAC Name | 1,3,5-tribromo-2,4,6-trichlorobenzene |
| SMILES | Clc1c(Br)c(Cl)c(Br)c(Cl)c1Br |
| InChI | InChI=1S/C6Br3Cl3/c7-1-4(10)2(8)6(12)3(9)5(1)11 |
| InChIKey | QOBBHAMPBAWXQF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.14 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|