C21H21ClN6O2S — CID 27763398
N'-[2-[[4-(2-chlorophenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 27763398) has the molecular formula C21H21ClN6O2S and a molecular weight of 456.96 g/mol. Its IUPAC name is N'-[2-[[4-(2-chlorophenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[4-(2-chlorophenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 27763398 |
| Molecular Formula | C21H21ClN6O2S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N'-[2-[[4-(2-chlorophenyl)-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nnc(N2CCCC2)n1-c1ccccc1Cl)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21ClN6O2S/c22-16-10-4-5-11-17(16)28-20(27-12-6-7-13-27)25-26-21(28)31-14-18(29)23-24-19(30)15-8-2-1-3-9-15/h1-5,8-11H,6-7,12-14H2,(H,23,29)(H,24,30) |
| InChIKey | WNUNKLGWRSNMIU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|