C12H13NO2S — CID 2777655
methyl 3-(2,5-dimethylpyrrol-1-yl)thiophene-2-carboxylate (PubChem CID 2777655) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is methyl 3-(2,5-dimethylpyrrol-1-yl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(2,5-dimethylpyrrol-1-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2777655 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | methyl 3-(2,5-dimethylpyrrol-1-yl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1-n1c(C)ccc1C |
| InChI | InChI=1S/C12H13NO2S/c1-8-4-5-9(2)13(8)10-6-7-16-11(10)12(14)15-3/h4-7H,1-3H3 |
| InChIKey | GPGHJQWNKOAJIK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_E(5)', 'substructure': 'N/A'} |
|---|