C19H17BrN4O2S — CID 27781619
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 27781619) has the molecular formula C19H17BrN4O2S and a molecular weight of 445.34 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 27781619 |
| Molecular Formula | C19H17BrN4O2S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)c1c[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C19H17BrN4O2S/c1-12-9-13(20)7-8-15(12)23-17(25)11-21-18(26)16-10-22-19(27)24(16)14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,21,26)(H,22,27)(H,23,25) |
| InChIKey | GYPDWKIUFWHIHX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|