C12H20N4O3S — CID 2778665
5-tert-butylsulfonyl-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 2778665) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-tert-butylsulfonyl-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 5-tert-butylsulfonyl-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 2778665 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-tert-butylsulfonyl-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CC(C)(C)S(=O)(=O)c1cnc(N2CCOCC2)nc1N |
| InChI | InChI=1S/C12H20N4O3S/c1-12(2,3)20(17,18)9-8-14-11(15-10(9)13)16-4-6-19-7-5-16/h8H,4-7H2,1-3H3,(H2,13,14,15) |
| InChIKey | GDHZZUDBHRLEQY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |