C11H18N4O3S — CID 2819754
2-morpholin-4-yl-5-propan-2-ylsulfonylpyrimidin-4-amine (PubChem CID 2819754) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-propan-2-ylsulfonylpyrimidin-4-amine.
| Compound Name | 2-morpholin-4-yl-5-propan-2-ylsulfonylpyrimidin-4-amine |
|---|---|
| PubChem CID | 2819754 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-morpholin-4-yl-5-propan-2-ylsulfonylpyrimidin-4-amine |
| SMILES | CC(C)S(=O)(=O)c1cnc(N2CCOCC2)nc1N |
| InChI | InChI=1S/C11H18N4O3S/c1-8(2)19(16,17)9-7-13-11(14-10(9)12)15-3-5-18-6-4-15/h7-8H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | NHYVDNBWXVAJRN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |