C7H12N4O2S — CID 2819789
5-propan-2-ylsulfonylpyrimidine-2,4-diamine (PubChem CID 2819789) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 5-propan-2-ylsulfonylpyrimidine-2,4-diamine.
| Compound Name | 5-propan-2-ylsulfonylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 2819789 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 5-propan-2-ylsulfonylpyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)c1cnc(N)nc1N |
| InChI | InChI=1S/C7H12N4O2S/c1-4(2)14(12,13)5-3-10-7(9)11-6(5)8/h3-4H,1-2H3,(H4,8,9,10,11) |
| InChIKey | ZFUGYCGYOYWQDM-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |