C14H8Cl3FN2O2 — CID 2779659
2,3,3-trichloro-N-[2-(4-fluorophenoxy)-3-pyridinyl]prop-2-enamide (PubChem CID 2779659) has the molecular formula C14H8Cl3FN2O2 and a molecular weight of 361.59 g/mol. Its IUPAC name is 2,3,3-trichloro-N-[2-(4-fluorophenoxy)-3-pyridinyl]prop-2-enamide.
| Compound Name | 2,3,3-trichloro-N-[2-(4-fluorophenoxy)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 2779659 |
| Molecular Formula | C14H8Cl3FN2O2 |
| Molecular Weight | 361.59 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 2,3,3-trichloro-N-[2-(4-fluorophenoxy)-3-pyridinyl]prop-2-enamide |
| SMILES | O=C(Nc1cccnc1Oc1ccc(F)cc1)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C14H8Cl3FN2O2/c15-11(12(16)17)13(21)20-10-2-1-7-19-14(10)22-9-5-3-8(18)4-6-9/h1-7H,(H,20,21) |
| InChIKey | WOUDAEMCYBFHMC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|