C28H20Cl2N2O4 — CID 27805166
(3R,3aS,6aR)-5-benzyl-3-[5-(2,5-dichlorophenyl)furan-2-yl]-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 27805166) has the molecular formula C28H20Cl2N2O4 and a molecular weight of 519.38 g/mol. Its IUPAC name is (3R,3aS,6aR)-5-benzyl-3-[5-(2,5-dichlorophenyl)furan-2-yl]-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aS,6aR)-5-benzyl-3-[5-(2,5-dichlorophenyl)furan-2-yl]-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 27805166 |
| Molecular Formula | C28H20Cl2N2O4 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | (3R,3aS,6aR)-5-benzyl-3-[5-(2,5-dichlorophenyl)furan-2-yl]-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@@H](ON(c3ccccc3)[C@H]2c2ccc(-c3cc(Cl)ccc3Cl)o2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H20Cl2N2O4/c29-18-11-12-21(30)20(15-18)22-13-14-23(35-22)25-24-26(36-32(25)19-9-5-2-6-10-19)28(34)31(27(24)33)16-17-7-3-1-4-8-17/h1-15,24-26H,16H2/t24-,25-,26+/m0/s1 |
| InChIKey | RDUKZWGBUMJSCS-KKUQBAQOSA-N |
| XLogP | 6.30 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|