C19H17ClN4O3S2 — CID 27808765
[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methanone (PubChem CID 27808765) has the molecular formula C19H17ClN4O3S2 and a molecular weight of 448.96 g/mol. Its IUPAC name is [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methanone.
| Compound Name | [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 27808765 |
| Molecular Formula | C19H17ClN4O3S2 |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H17ClN4O3S2/c1-12-17(29-18(21-12)16-3-2-10-28-16)19(25)23-8-6-22(7-9-23)14-5-4-13(20)11-15(14)24(26)27/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | XZZNMOFWBJRYOI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|